C12H18FN3 — CID 123513103
N-(7-fluorodeca-1,4,6,8-tetraen-2-yldiazenyl)-N-methylmethanamine (PubChem CID 123513103) has the molecular formula C12H18FN3 and a molecular weight of 223.29 g/mol. Its IUPAC name is N-(7-fluorodeca-1,4,6,8-tetraen-2-yldiazenyl)-N-methylmethanamine.
| Compound Name | N-(7-fluorodeca-1,4,6,8-tetraen-2-yldiazenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 123513103 |
| Molecular Formula | C12H18FN3 |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | N-(7-fluorodeca-1,4,6,8-tetraen-2-yldiazenyl)-N-methylmethanamine |
| SMILES | C=C(CC=CC=C(F)C=CC)/N=N/N(C)C |
| InChI | InChI=1S/C12H18FN3/c1-5-8-12(13)10-7-6-9-11(2)14-15-16(3)4/h5-8,10H,2,9H2,1,3-4H3/b7-6?,8-5?,12-10?,15-14+ |
| InChIKey | IBTVKXISFDVFNR-ZFOREXAVSA-N |
| XLogP | 3.80 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|