C14H22N2 — CID 155699452
[(2E,4Z)-hepta-2,4-dien-3-yl]-[(2Z,4E)-hepta-2,4-dien-4-yl]diazene (PubChem CID 155699452) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is [(2E,4Z)-hepta-2,4-dien-3-yl]-[(2Z,4E)-hepta-2,4-dien-4-yl]diazene.
| Compound Name | [(2E,4Z)-hepta-2,4-dien-3-yl]-[(2Z,4E)-hepta-2,4-dien-4-yl]diazene |
|---|---|
| PubChem CID | 155699452 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | [(2E,4Z)-hepta-2,4-dien-3-yl]-[(2Z,4E)-hepta-2,4-dien-4-yl]diazene |
| SMILES | C/C=C\C(=C/CC)\N=N/C(/C=C\CC)=C/C |
| InChI | InChI=1S/C14H22N2/c1-5-9-12-13(8-4)15-16-14(10-6-2)11-7-3/h6,8-12H,5,7H2,1-4H3/b10-6-,12-9-,13-8+,14-11+,16-15+ |
| InChIKey | RMZQBSCOPNKVII-KRHQAVLFSA-N |
| XLogP | 5.18 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|