C14H28N2 — CID 143754890
N,N-dimethylmethanamine;(2E,4Z,6Z)-N,N-dimethylnona-2,4,6-trien-3-amine (PubChem CID 143754890) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is N,N-dimethylmethanamine;(2E,4Z,6Z)-N,N-dimethylnona-2,4,6-trien-3-amine.
| Compound Name | N,N-dimethylmethanamine;(2E,4Z,6Z)-N,N-dimethylnona-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 143754890 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | N,N-dimethylmethanamine;(2E,4Z,6Z)-N,N-dimethylnona-2,4,6-trien-3-amine |
| SMILES | C/C=C(\C=C/C=C\CC)N(C)C.CN(C)C |
| InChI | InChI=1S/C11H19N.C3H9N/c1-5-7-8-9-10-11(6-2)12(3)4;1-4(2)3/h6-10H,5H2,1-4H3;1-3H3/b8-7-,10-9-,11-6+; |
| InChIKey | BPVJYDCEMCJBPG-BXFXUTCISA-N |
| XLogP | 3.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|