C9H12NY- — CID 59870101
N,N,3-trimethylbenzene-4-id-1-amine;yttrium (PubChem CID 59870101) has the molecular formula C9H12NY- and a molecular weight of 223.11 g/mol. Its IUPAC name is N,N,3-trimethylbenzene-4-id-1-amine;yttrium.
| Compound Name | N,N,3-trimethylbenzene-4-id-1-amine;yttrium |
|---|---|
| PubChem CID | 59870101 |
| Molecular Formula | C9H12NY- |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | N,N,3-trimethylbenzene-4-id-1-amine;yttrium |
| SMILES | Cc1[c-]ccc(N(C)C)c1.[Y] |
| InChI | InChI=1S/C9H12N.Y/c1-8-5-4-6-9(7-8)10(2)3;/h4,6-7H,1-3H3;/q-1; |
| InChIKey | GGCXAWFKQFRNIB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|