C9H9F3NY- — CID 161387175
3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium (PubChem CID 161387175) has the molecular formula C9H9F3NY- and a molecular weight of 277.08 g/mol. Its IUPAC name is 3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium.
| Compound Name | 3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium |
|---|---|
| PubChem CID | 161387175 |
| Molecular Formula | C9H9F3NY- |
| Molecular Weight | 277.08 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium |
| SMILES | C=C1C=CC(C)=[C-]N1CC(F)(F)F.[Y] |
| InChI | InChI=1S/C9H9F3N.Y/c1-7-3-4-8(2)13(5-7)6-9(10,11)12;/h3-4H,2,6H2,1H3;/q-1; |
| InChIKey | WJCJAHPIAOJOLM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.08 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|