About 3-fluoro-N,N,5-trimethyl-2-methylidenepyridin-1-amine
3-fluoro-N,N,5-trimethyl-2-methylidenepyridin-1-amine (PubChem CID 158083783) has the molecular formula C9H13FN2
and a molecular weight of 168.21 g/mol. Its IUPAC name is 3-fluoro-N,N,5-trimethyl-2-methylidenepyridin-1-amine.
Analyze 3-fluoro-N,N,5-trimethyl-2-methylidenepyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N,N,5-trimethyl-2-methylidenepyridin-1-amine?
The IUPAC name of 3-fluoro-N,N,5-trimethyl-2-methylidenepyridin-1-amine (CID 158083783) is 3-fluoro-N,N,5-trimethyl-2-methylidenepyridin-1-amine.
What is the SMILES notation for 3-fluoro-N,N,5-trimethyl-2-methylidenepyridin-1-amine?
The canonical SMILES for 3-fluoro-N,N,5-trimethyl-2-methylidenepyridin-1-amine is C=C1C(F)=CC(C)=CN1N(C)C.
What is the InChIKey of 3-fluoro-N,N,5-trimethyl-2-methylidenepyridin-1-amine?
The InChIKey is HQQBHEAFEQKFNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FN2/c1-7-5-9(10)8(2)12(6-7)11(3)4/h5-6H,2H2,1,3-4H3.
What are the key properties of 3-fluoro-N,N,5-trimethyl-2-methylidenepyridin-1-amine?
3-fluoro-N,N,5-trimethyl-2-methylidenepyridin-1-amine has a molecular weight of 168.21 g/mol, XLogP of 2.05, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N,N,5-trimethyl-2-methylidenepyridin-1-amine is sourced from PubChem (CID 158083783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).