About 4-(difluoromethyl)-1,5-dimethyl-2-methylidenepyridine
4-(difluoromethyl)-1,5-dimethyl-2-methylidenepyridine (PubChem CID 145359778) has the molecular formula C9H11F2N
and a molecular weight of 171.19 g/mol. Its IUPAC name is 4-(difluoromethyl)-1,5-dimethyl-2-methylidenepyridine.
Analyze 4-(difluoromethyl)-1,5-dimethyl-2-methylidenepyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-1,5-dimethyl-2-methylidenepyridine?
The IUPAC name of 4-(difluoromethyl)-1,5-dimethyl-2-methylidenepyridine (CID 145359778) is 4-(difluoromethyl)-1,5-dimethyl-2-methylidenepyridine.
What is the SMILES notation for 4-(difluoromethyl)-1,5-dimethyl-2-methylidenepyridine?
The canonical SMILES for 4-(difluoromethyl)-1,5-dimethyl-2-methylidenepyridine is C=C1C=C(C(F)F)C(C)=CN1C.
What is the InChIKey of 4-(difluoromethyl)-1,5-dimethyl-2-methylidenepyridine?
The InChIKey is WCPZQTYUBIXLHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2N/c1-6-5-12(3)7(2)4-8(6)9(10)11/h4-5,9H,2H2,1,3H3.
What are the key properties of 4-(difluoromethyl)-1,5-dimethyl-2-methylidenepyridine?
4-(difluoromethyl)-1,5-dimethyl-2-methylidenepyridine has a molecular weight of 171.19 g/mol, XLogP of 2.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-1,5-dimethyl-2-methylidenepyridine is sourced from PubChem (CID 145359778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).