C10H12F3N2Y- — CID 160667563
N,N,3-trimethyl-6-methylidene-5-(trifluoromethyl)-2H-pyridin-2-id-1-amine;yttrium (PubChem CID 160667563) has the molecular formula C10H12F3N2Y- and a molecular weight of 306.12 g/mol. Its IUPAC name is N,N,3-trimethyl-6-methylidene-5-(trifluoromethyl)-2H-pyridin-2-id-1-amine;yttrium.
| Compound Name | N,N,3-trimethyl-6-methylidene-5-(trifluoromethyl)-2H-pyridin-2-id-1-amine;yttrium |
|---|---|
| PubChem CID | 160667563 |
| Molecular Formula | C10H12F3N2Y- |
| Molecular Weight | 306.12 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | N,N,3-trimethyl-6-methylidene-5-(trifluoromethyl)-2H-pyridin-2-id-1-amine;yttrium |
| SMILES | C=C1C(C(F)(F)F)=CC(C)=[C-]N1N(C)C.[Y] |
| InChI | InChI=1S/C10H12F3N2.Y/c1-7-5-9(10(11,12)13)8(2)15(6-7)14(3)4;/h5H,2H2,1,3-4H3;/q-1; |
| InChIKey | JYBDFRKNBPUIIY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.12 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|