C9H9F3NY- — CID 158142944
1,3-dimethyl-6-methylidene-5-(trifluoromethyl)-2H-pyridin-2-ide;yttrium (PubChem CID 158142944) has the molecular formula C9H9F3NY- and a molecular weight of 277.08 g/mol. Its IUPAC name is 1,3-dimethyl-6-methylidene-5-(trifluoromethyl)-2H-pyridin-2-ide;yttrium.
| Compound Name | 1,3-dimethyl-6-methylidene-5-(trifluoromethyl)-2H-pyridin-2-ide;yttrium |
|---|---|
| PubChem CID | 158142944 |
| Molecular Formula | C9H9F3NY- |
| Molecular Weight | 277.08 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 1,3-dimethyl-6-methylidene-5-(trifluoromethyl)-2H-pyridin-2-ide;yttrium |
| SMILES | C=C1C(C(F)(F)F)=CC(C)=[C-]N1C.[Y] |
| InChI | InChI=1S/C9H9F3N.Y/c1-6-4-8(9(10,11)12)7(2)13(3)5-6;/h4H,2H2,1,3H3;/q-1; |
| InChIKey | RUHSBHJXTJWZJE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.08 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|