About N-methyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine
N-methyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine (PubChem CID 146330691) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is N-methyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine.
Analyze N-methyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine?
The IUPAC name of N-methyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine (CID 146330691) is N-methyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for N-methyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for N-methyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine is C=C(C)N(C)C1=CCCC=C1.
What is the InChIKey of N-methyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine?
The InChIKey is RMGHGEGZXRQTDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-9(2)11(3)10-7-5-4-6-8-10/h5,7-8H,1,4,6H2,2-3H3.
What are the key properties of N-methyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine?
N-methyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine has a molecular weight of 149.24 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-prop-1-en-2-ylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 146330691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).