C13H17F2N — CID 169166356
(6Z)-2-(difluoromethyl)-6-[(Z)-hex-2-enylidene]-1-methylpyridine (PubChem CID 169166356) has the molecular formula C13H17F2N and a molecular weight of 225.28 g/mol. Its IUPAC name is (6Z)-2-(difluoromethyl)-6-[(Z)-hex-2-enylidene]-1-methylpyridine.
| Compound Name | (6Z)-2-(difluoromethyl)-6-[(Z)-hex-2-enylidene]-1-methylpyridine |
|---|---|
| PubChem CID | 169166356 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (6Z)-2-(difluoromethyl)-6-[(Z)-hex-2-enylidene]-1-methylpyridine |
| SMILES | CCC/C=C\C=C1\C=CC=C(C(F)F)N1C |
| InChI | InChI=1S/C13H17F2N/c1-3-4-5-6-8-11-9-7-10-12(13(14)15)16(11)2/h5-10,13H,3-4H2,1-2H3/b6-5-,11-8- |
| InChIKey | RQCCSPWCDVXDLH-VRULOHATSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |