C10H19N — CID 145201292
N,N-dimethylcyclohexa-1,5-dien-1-amine;ethane (PubChem CID 145201292) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is N,N-dimethylcyclohexa-1,5-dien-1-amine;ethane.
| Compound Name | N,N-dimethylcyclohexa-1,5-dien-1-amine;ethane |
|---|---|
| PubChem CID | 145201292 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | N,N-dimethylcyclohexa-1,5-dien-1-amine;ethane |
| SMILES | CC.CN(C)C1=CCCC=C1 |
| InChI | InChI=1S/C8H13N.C2H6/c1-9(2)8-6-4-3-5-7-8;1-2/h4,6-7H,3,5H2,1-2H3;1-2H3 |
| InChIKey | NQFNSZCOAYLUAX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |