C10H15LiN2 — CID 11116474
lithium 1-N,1-N,3-N,3-N-tetramethylbenzene-2-ide-1,3-diamine (PubChem CID 11116474) has the molecular formula C10H15LiN2 and a molecular weight of 170.18 g/mol. Its IUPAC name is lithium 1-N,1-N,3-N,3-N-tetramethylbenzene-2-ide-1,3-diamine.
| Compound Name | lithium 1-N,1-N,3-N,3-N-tetramethylbenzene-2-ide-1,3-diamine |
|---|---|
| PubChem CID | 11116474 |
| Molecular Formula | C10H15LiN2 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | lithium 1-N,1-N,3-N,3-N-tetramethylbenzene-2-ide-1,3-diamine |
| SMILES | CN(C)c1[c-]c(N(C)C)ccc1.[Li+] |
| InChI | InChI=1S/C10H15N2.Li/c1-11(2)9-6-5-7-10(8-9)12(3)4;/h5-7H,1-4H3;/q-1;+1 |
| InChIKey | KGNJDWGFHUJIIX-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|