C13H19IN3+ — CID 163513601
amino-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[(3E)-hexa-1,3,5-trien-3-yl]-(iodoamino)azanium (PubChem CID 163513601) has the molecular formula C13H19IN3+ and a molecular weight of 344.22 g/mol. Its IUPAC name is amino-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[(3E)-hexa-1,3,5-trien-3-yl]-(iodoamino)azanium.
| Compound Name | amino-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[(3E)-hexa-1,3,5-trien-3-yl]-(iodoamino)azanium |
|---|---|
| PubChem CID | 163513601 |
| Molecular Formula | C13H19IN3+ |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | amino-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[(3E)-hexa-1,3,5-trien-3-yl]-(iodoamino)azanium |
| SMILES | C=C/C=C(\C=C)[N+](N)(NI)C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C13H19IN3/c1-5-9-12(8-4)17(15,16-14)13(10-6-2)11-7-3/h5-11,16H,1-2,4,15H2,3H3/q+1/b11-7-,12-9+,13-10+ |
| InChIKey | MSKDSUJNJLSAHJ-JFBJLCBDSA-N |
| XLogP | 3.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|