C8H18N2 — CID 166131564
ethane;1-methyl-1-[(2E)-penta-2,4-dien-2-yl]hydrazine (PubChem CID 166131564) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is ethane;1-methyl-1-[(2E)-penta-2,4-dien-2-yl]hydrazine.
| Compound Name | ethane;1-methyl-1-[(2E)-penta-2,4-dien-2-yl]hydrazine |
|---|---|
| PubChem CID | 166131564 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | ethane;1-methyl-1-[(2E)-penta-2,4-dien-2-yl]hydrazine |
| SMILES | C=C/C=C(\C)N(C)N.CC |
| InChI | InChI=1S/C6H12N2.C2H6/c1-4-5-6(2)8(3)7;1-2/h4-5H,1,7H2,2-3H3;1-2H3/b6-5+; |
| InChIKey | LXQLPLNLCFRROX-IPZCTEOASA-N |
| XLogP | 1.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|