C8H16N2 — CID 123795443
1-penta-2,4-dien-2-yl-1-propan-2-ylhydrazine (PubChem CID 123795443) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 1-penta-2,4-dien-2-yl-1-propan-2-ylhydrazine.
| Compound Name | 1-penta-2,4-dien-2-yl-1-propan-2-ylhydrazine |
|---|---|
| PubChem CID | 123795443 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 1-penta-2,4-dien-2-yl-1-propan-2-ylhydrazine |
| SMILES | C=CC=C(C)N(N)C(C)C |
| InChI | InChI=1S/C8H16N2/c1-5-6-8(4)10(9)7(2)3/h5-7H,1,9H2,2-4H3 |
| InChIKey | NORLVQHTPXKDNB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|