C20H17F4NO5S — CID 140621926
[4-(1-fluoro-3-phenylmethoxypropan-2-yl)oxyquinolin-2-yl] trifluoromethanesulfonate (PubChem CID 140621926) has the molecular formula C20H17F4NO5S and a molecular weight of 459.42 g/mol. Its IUPAC name is [4-(1-fluoro-3-phenylmethoxypropan-2-yl)oxyquinolin-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-(1-fluoro-3-phenylmethoxypropan-2-yl)oxyquinolin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 140621926 |
| Molecular Formula | C20H17F4NO5S |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | [4-(1-fluoro-3-phenylmethoxypropan-2-yl)oxyquinolin-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(OC(CF)COCc2ccccc2)c2ccccc2n1)C(F)(F)F |
| InChI | InChI=1S/C20H17F4NO5S/c21-11-15(13-28-12-14-6-2-1-3-7-14)29-18-10-19(30-31(26,27)20(22,23)24)25-17-9-5-4-8-16(17)18/h1-10,15H,11-13H2 |
| InChIKey | ZWPDKUGODHKQBV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|