C26H26F2O6S2 — CID 140622339
2-[2-[4-bis(4-methylphenyl)sulfonio-2,6-dimethylphenoxy]acetyl]oxy-1,1-difluoroethanesulfonate (PubChem CID 140622339) has the molecular formula C26H26F2O6S2 and a molecular weight of 536.62 g/mol. Its IUPAC name is 2-[2-[4-bis(4-methylphenyl)sulfonio-2,6-dimethylphenoxy]acetyl]oxy-1,1-difluoroethanesulfonate.
| Compound Name | 2-[2-[4-bis(4-methylphenyl)sulfonio-2,6-dimethylphenoxy]acetyl]oxy-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 140622339 |
| Molecular Formula | C26H26F2O6S2 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | 2-[2-[4-bis(4-methylphenyl)sulfonio-2,6-dimethylphenoxy]acetyl]oxy-1,1-difluoroethanesulfonate |
| SMILES | Cc1ccc([S+](c2ccc(C)cc2)c2cc(C)c(OCC(=O)OCC(F)(F)S(=O)(=O)[O-])c(C)c2)cc1 |
| InChI | InChI=1S/C26H26F2O6S2/c1-17-5-9-21(10-6-17)35(22-11-7-18(2)8-12-22)23-13-19(3)25(20(4)14-23)33-15-24(29)34-16-26(27,28)36(30,31)32/h5-14H,15-16H2,1-4H3 |
| InChIKey | FIPMAMZYNYBCCU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|