C16H24FN2 — CID 140622478
CID 140622478 (PubChem CID 140622478) has the molecular formula C16H24FN2 and a molecular weight of 263.38 g/mol.
| Compound Name | CID 140622478 |
|---|---|
| PubChem CID | 140622478 |
| Molecular Formula | C16H24FN2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | — |
| SMILES | C[C](C)c1cc(F)cc(CNC2CCN(C)CC2)c1 |
| InChI | InChI=1S/C16H24FN2/c1-12(2)14-8-13(9-15(17)10-14)11-18-16-4-6-19(3)7-5-16/h8-10,16,18H,4-7,11H2,1-3H3 |
| InChIKey | FQDDEPPJNACKSW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |