C17H26FN2 — CID 140622443
CID 140622443 (PubChem CID 140622443) has the molecular formula C17H26FN2 and a molecular weight of 277.41 g/mol.
| Compound Name | CID 140622443 |
|---|---|
| PubChem CID | 140622443 |
| Molecular Formula | C17H26FN2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.21 |
| IUPAC Name | — |
| SMILES | C[C](C)c1cc(F)cc(CN2CCC(N(C)C)CC2)c1 |
| InChI | InChI=1S/C17H26FN2/c1-13(2)15-9-14(10-16(18)11-15)12-20-7-5-17(6-8-20)19(3)4/h9-11,17H,5-8,12H2,1-4H3 |
| InChIKey | PGJYEDOIWODWFW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |