About (4S)-1-[(3,5-difluoro-4-methoxyphenyl)methyl]-N,N-dimethylazepan-4-amine
(4S)-1-[(3,5-difluoro-4-methoxyphenyl)methyl]-N,N-dimethylazepan-4-amine (PubChem CID 99946945) has the molecular formula C16H24F2N2O
and a molecular weight of 298.38 g/mol. Its IUPAC name is (4S)-1-[(3,5-difluoro-4-methoxyphenyl)methyl]-N,N-dimethylazepan-4-amine.
Molecular Properties
| Compound Name | (4S)-1-[(3,5-difluoro-4-methoxyphenyl)methyl]-N,N-dimethylazepan-4-amine |
| PubChem CID | 99946945 |
| Molecular Formula | C16H24F2N2O |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (4S)-1-[(3,5-difluoro-4-methoxyphenyl)methyl]-N,N-dimethylazepan-4-amine |
| SMILES | COc1c(F)cc(CN2CCC[C@H](N(C)C)CC2)cc1F |
| InChI | InChI=1S/C16H24F2N2O/c1-19(2)13-5-4-7-20(8-6-13)11-12-9-14(17)16(21-3)15(18)10-12/h9-10,13H,4-8,11H2,1-3H3/t13-/m0/s1 |
| InChIKey | ZQYSSZHTGYUETI-ZDUSSCGKSA-N |
| XLogP | 2.89 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-1-[(3,5-difluoro-4-methoxyphenyl)methyl]-N,N-dimethylazepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1-[(3,5-difluoro-4-methoxyphenyl)methyl]-N,N-dimethylazepan-4-amine?
The IUPAC name of (4S)-1-[(3,5-difluoro-4-methoxyphenyl)methyl]-N,N-dimethylazepan-4-amine (CID 99946945) is (4S)-1-[(3,5-difluoro-4-methoxyphenyl)methyl]-N,N-dimethylazepan-4-amine.
What is the SMILES notation for (4S)-1-[(3,5-difluoro-4-methoxyphenyl)methyl]-N,N-dimethylazepan-4-amine?
The canonical SMILES for (4S)-1-[(3,5-difluoro-4-methoxyphenyl)methyl]-N,N-dimethylazepan-4-amine is COc1c(F)cc(CN2CCC[C@H](N(C)C)CC2)cc1F.
What is the InChIKey of (4S)-1-[(3,5-difluoro-4-methoxyphenyl)methyl]-N,N-dimethylazepan-4-amine?
The InChIKey is ZQYSSZHTGYUETI-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H24F2N2O/c1-19(2)13-5-4-7-20(8-6-13)11-12-9-14(17)16(21-3)15(18)10-12/h9-10,13H,4-8,11H2,1-3H3/t13-/m0/s1.
What are the key properties of (4S)-1-[(3,5-difluoro-4-methoxyphenyl)methyl]-N,N-dimethylazepan-4-amine?
(4S)-1-[(3,5-difluoro-4-methoxyphenyl)methyl]-N,N-dimethylazepan-4-amine has a molecular weight of 298.38 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1-[(3,5-difluoro-4-methoxyphenyl)methyl]-N,N-dimethylazepan-4-amine is sourced from PubChem (CID 99946945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).