About CID 140622433
CID 140622433 (PubChem CID 140622433) has the molecular formula C16H25FN3O2S
and a molecular weight of 342.46 g/mol.
Molecular Properties
| Compound Name | CID 140622433 |
| PubChem CID | 140622433 |
| Molecular Formula | C16H25FN3O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | — |
| SMILES | C[C](C)c1cc(F)cc(CN2CCN(S(=O)(=O)N(C)C)CC2)c1 |
| InChI | InChI=1S/C16H25FN3O2S/c1-13(2)15-9-14(10-16(17)11-15)12-19-5-7-20(8-6-19)23(21,22)18(3)4/h9-11H,5-8,12H2,1-4H3 |
| InChIKey | JISWEPGLPDBCPH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 140622433 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140622433?
The IUPAC name of CID 140622433 (CID 140622433) is not available.
What is the SMILES notation for CID 140622433?
The canonical SMILES for CID 140622433 is C[C](C)c1cc(F)cc(CN2CCN(S(=O)(=O)N(C)C)CC2)c1.
What is the InChIKey of CID 140622433?
The InChIKey is JISWEPGLPDBCPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25FN3O2S/c1-13(2)15-9-14(10-16(17)11-15)12-19-5-7-20(8-6-19)23(21,22)18(3)4/h9-11H,5-8,12H2,1-4H3.
What are the key properties of CID 140622433?
CID 140622433 has a molecular weight of 342.46 g/mol, XLogP of 1.71, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140622433 is sourced from PubChem (CID 140622433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).