C16H25FN3O2S — CID 140622433
CID 140622433 (PubChem CID 140622433) has the molecular formula C16H25FN3O2S and a molecular weight of 342.46 g/mol.
| Compound Name | CID 140622433 |
|---|---|
| PubChem CID | 140622433 |
| Molecular Formula | C16H25FN3O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | — |
| SMILES | C[C](C)c1cc(F)cc(CN2CCN(S(=O)(=O)N(C)C)CC2)c1 |
| InChI | InChI=1S/C16H25FN3O2S/c1-13(2)15-9-14(10-16(17)11-15)12-19-5-7-20(8-6-19)23(21,22)18(3)4/h9-11H,5-8,12H2,1-4H3 |
| InChIKey | JISWEPGLPDBCPH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |