C16H22FN2O — CID 140622444
CID 140622444 (PubChem CID 140622444) has the molecular formula C16H22FN2O and a molecular weight of 277.36 g/mol.
| Compound Name | CID 140622444 |
|---|---|
| PubChem CID | 140622444 |
| Molecular Formula | C16H22FN2O |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | — |
| SMILES | CNC(=O)C1CCN(Cc2cc(F)cc([C](C)C)c2)C1 |
| InChI | InChI=1S/C16H22FN2O/c1-11(2)14-6-12(7-15(17)8-14)9-19-5-4-13(10-19)16(20)18-3/h6-8,13H,4-5,9-10H2,1-3H3,(H,18,20) |
| InChIKey | TTZUYXSMADESHY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |