C15H19F3N2O — CID 174748455
N-methyl-N-[1-[(3,4,5-trifluorophenyl)methyl]piperidin-4-yl]acetamide (PubChem CID 174748455) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is N-methyl-N-[1-[(3,4,5-trifluorophenyl)methyl]piperidin-4-yl]acetamide.
| Compound Name | N-methyl-N-[1-[(3,4,5-trifluorophenyl)methyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 174748455 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-methyl-N-[1-[(3,4,5-trifluorophenyl)methyl]piperidin-4-yl]acetamide |
| SMILES | CC(=O)N(C)C1CCN(Cc2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C15H19F3N2O/c1-10(21)19(2)12-3-5-20(6-4-12)9-11-7-13(16)15(18)14(17)8-11/h7-8,12H,3-6,9H2,1-2H3 |
| InChIKey | HZWZXBIWNPKPIX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|