C18H29F4N5O — CID 140623026
N-[(Z)-N-cyclopentyl-N'-[5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]-3-fluoro-4-methylcyclohexane-1-carboxamide (PubChem CID 140623026) has the molecular formula C18H29F4N5O and a molecular weight of 407.46 g/mol. Its IUPAC name is N-[(Z)-N-cyclopentyl-N'-[5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]-3-fluoro-4-methylcyclohexane-1-carboxamide.
| Compound Name | N-[(Z)-N-cyclopentyl-N'-[5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]-3-fluoro-4-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140623026 |
| Molecular Formula | C18H29F4N5O |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | N-[(Z)-N-cyclopentyl-N'-[5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]-3-fluoro-4-methylcyclohexane-1-carboxamide |
| SMILES | CC1CCC(C(=O)N/C(=N\C2CC(C(F)(F)F)NN2)NC2CCCC2)CC1F |
| InChI | InChI=1S/C18H29F4N5O/c1-10-6-7-11(8-13(10)19)16(28)25-17(23-12-4-2-3-5-12)24-15-9-14(26-27-15)18(20,21)22/h10-15,26-27H,2-9H2,1H3,(H2,23,24,25,28) |
| InChIKey | CHZAQCQJRDLUSP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|