C20H33F4N5O — CID 140623057
N-[(E)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-propan-2-ylcarbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide (PubChem CID 140623057) has the molecular formula C20H33F4N5O and a molecular weight of 435.51 g/mol. Its IUPAC name is N-[(E)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-propan-2-ylcarbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-[(E)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-propan-2-ylcarbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140623057 |
| Molecular Formula | C20H33F4N5O |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | N-[(E)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-propan-2-ylcarbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide |
| SMILES | CC(C)N/C(=N\C1CC(C2CC(F)CC(F)C2)NN1)NC(=O)C1CCC(F)C(F)C1 |
| InChI | InChI=1S/C20H33F4N5O/c1-10(2)25-20(27-19(30)11-3-4-15(23)16(24)7-11)26-18-9-17(28-29-18)12-5-13(21)8-14(22)6-12/h10-18,28-29H,3-9H2,1-2H3,(H2,25,26,27,30) |
| InChIKey | NHIFXCQRAUWLHZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|