C16H19NO6 — CID 14062314
trimethyl (2R,3R,4R,5S)-5-phenylpyrrolidine-2,3,4-tricarboxylate (PubChem CID 14062314) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is trimethyl (2R,3R,4R,5S)-5-phenylpyrrolidine-2,3,4-tricarboxylate.
| Compound Name | trimethyl (2R,3R,4R,5S)-5-phenylpyrrolidine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 14062314 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | trimethyl (2R,3R,4R,5S)-5-phenylpyrrolidine-2,3,4-tricarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(=O)OC)[C@H](C(=O)OC)N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H19NO6/c1-21-14(18)10-11(15(19)22-2)13(16(20)23-3)17-12(10)9-7-5-4-6-8-9/h4-8,10-13,17H,1-3H3/t10-,11-,12-,13-/m1/s1 |
| InChIKey | GIFDWMSXDIZYQF-FDYHWXHSSA-N |
| XLogP | 0.45 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|