C31H31N3O3 — CID 140623655
N-cyclohexyl-N-methyl-3-[1-methyl-6-oxo-3-(2-phenoxyphenyl)pyridazin-4-yl]benzamide (PubChem CID 140623655) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-3-[1-methyl-6-oxo-3-(2-phenoxyphenyl)pyridazin-4-yl]benzamide.
| Compound Name | N-cyclohexyl-N-methyl-3-[1-methyl-6-oxo-3-(2-phenoxyphenyl)pyridazin-4-yl]benzamide |
|---|---|
| PubChem CID | 140623655 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | N-cyclohexyl-N-methyl-3-[1-methyl-6-oxo-3-(2-phenoxyphenyl)pyridazin-4-yl]benzamide |
| SMILES | CN(C(=O)c1cccc(-c2cc(=O)n(C)nc2-c2ccccc2Oc2ccccc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C31H31N3O3/c1-33(24-14-5-3-6-15-24)31(36)23-13-11-12-22(20-23)27-21-29(35)34(2)32-30(27)26-18-9-10-19-28(26)37-25-16-7-4-8-17-25/h4,7-13,16-21,24H,3,5-6,14-15H2,1-2H3 |
| InChIKey | YCJJHXXMJXABFI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |