C29H28N2O3 — CID 140623665
5-[4-[cyclopentyl(hydroxy)methyl]phenyl]-2-methyl-6-(2-phenoxyphenyl)pyridazin-3-one (PubChem CID 140623665) has the molecular formula C29H28N2O3 and a molecular weight of 452.55 g/mol. Its IUPAC name is 5-[4-[cyclopentyl(hydroxy)methyl]phenyl]-2-methyl-6-(2-phenoxyphenyl)pyridazin-3-one.
| Compound Name | 5-[4-[cyclopentyl(hydroxy)methyl]phenyl]-2-methyl-6-(2-phenoxyphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 140623665 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 5-[4-[cyclopentyl(hydroxy)methyl]phenyl]-2-methyl-6-(2-phenoxyphenyl)pyridazin-3-one |
| SMILES | Cn1nc(-c2ccccc2Oc2ccccc2)c(-c2ccc(C(O)C3CCCC3)cc2)cc1=O |
| InChI | InChI=1S/C29H28N2O3/c1-31-27(32)19-25(20-15-17-22(18-16-20)29(33)21-9-5-6-10-21)28(30-31)24-13-7-8-14-26(24)34-23-11-3-2-4-12-23/h2-4,7-8,11-19,21,29,33H,5-6,9-10H2,1H3 |
| InChIKey | MTRSEIRXGISADN-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |