C21H6F18N3P — CID 140625085
tris[2,6-bis(trifluoromethyl)-3-pyridinyl]phosphane (PubChem CID 140625085) has the molecular formula C21H6F18N3P and a molecular weight of 673.24 g/mol. Its IUPAC name is tris[2,6-bis(trifluoromethyl)-3-pyridinyl]phosphane.
| Compound Name | tris[2,6-bis(trifluoromethyl)-3-pyridinyl]phosphane |
|---|---|
| PubChem CID | 140625085 |
| Molecular Formula | C21H6F18N3P |
| Molecular Weight | 673.24 g/mol |
| Exact Mass | 673.00 |
| IUPAC Name | tris[2,6-bis(trifluoromethyl)-3-pyridinyl]phosphane |
| SMILES | FC(F)(F)c1ccc(P(c2ccc(C(F)(F)F)nc2C(F)(F)F)c2ccc(C(F)(F)F)nc2C(F)(F)F)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C21H6F18N3P/c22-16(23,24)10-4-1-7(13(40-10)19(31,32)33)43(8-2-5-11(17(25,26)27)41-14(8)20(34,35)36)9-3-6-12(18(28,29)30)42-15(9)21(37,38)39/h1-6H |
| InChIKey | CIHIZLGVNOFVFY-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.24 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|