C9H12Cl3NO — CID 140626356
3-amino-1-(3,4-dichlorophenyl)propan-1-ol;hydrochloride (PubChem CID 140626356) has the molecular formula C9H12Cl3NO and a molecular weight of 256.56 g/mol. Its IUPAC name is 3-amino-1-(3,4-dichlorophenyl)propan-1-ol;hydrochloride.
| Compound Name | 3-amino-1-(3,4-dichlorophenyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 140626356 |
| Molecular Formula | C9H12Cl3NO |
| Molecular Weight | 256.56 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 3-amino-1-(3,4-dichlorophenyl)propan-1-ol;hydrochloride |
| SMILES | Cl.NCCC(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H11Cl2NO.ClH/c10-7-2-1-6(5-8(7)11)9(13)3-4-12;/h1-2,5,9,13H,3-4,12H2;1H |
| InChIKey | BIJYWFCMROHYAM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |