C41H41FN8O — CID 140628477
(2R)-N-[(1R,3S)-3-[[5-fluoro-2-(1-tritylpyrazolo[5,4-b]pyridin-3-yl)pyrimidin-4-yl]amino]cyclohexyl]-2-methylpyrrolidine-1-carboxamide (PubChem CID 140628477) has the molecular formula C41H41FN8O and a molecular weight of 680.83 g/mol. Its IUPAC name is (2R)-N-[(1R,3S)-3-[[5-fluoro-2-(1-tritylpyrazolo[5,4-b]pyridin-3-yl)pyrimidin-4-yl]amino]cyclohexyl]-2-methylpyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-[(1R,3S)-3-[[5-fluoro-2-(1-tritylpyrazolo[5,4-b]pyridin-3-yl)pyrimidin-4-yl]amino]cyclohexyl]-2-methylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 140628477 |
| Molecular Formula | C41H41FN8O |
| Molecular Weight | 680.83 g/mol |
| Exact Mass | 680.34 |
| IUPAC Name | (2R)-N-[(1R,3S)-3-[[5-fluoro-2-(1-tritylpyrazolo[5,4-b]pyridin-3-yl)pyrimidin-4-yl]amino]cyclohexyl]-2-methylpyrrolidine-1-carboxamide |
| SMILES | C[C@@H]1CCCN1C(=O)N[C@@H]1CCC[C@H](Nc2nc(-c3nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c4ncccc34)ncc2F)C1 |
| InChI | InChI=1S/C41H41FN8O/c1-28-14-13-25-49(28)40(51)46-33-22-11-21-32(26-33)45-37-35(42)27-44-38(47-37)36-34-23-12-24-43-39(34)50(48-36)41(29-15-5-2-6-16-29,30-17-7-3-8-18-30)31-19-9-4-10-20-31/h2-10,12,15-20,23-24,27-28,32-33H,11,13-14,21-22,25-26H2,1H3,(H,46,51)(H,44,45,47)/t28-,32+,33-/m1/s1 |
| InChIKey | KYHKKBXEYBEZEN-ZSUPJWAMSA-N |
| XLogP | 7.78 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.83 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|