C34H30BN3O — CID 140630609
14-methyl-4-(3-pyridin-2-ylphenoxy)-8-(2,4,6-trimethylphenyl)-1,14-diaza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12-hexaene (PubChem CID 140630609) has the molecular formula C34H30BN3O and a molecular weight of 507.45 g/mol. Its IUPAC name is 14-methyl-4-(3-pyridin-2-ylphenoxy)-8-(2,4,6-trimethylphenyl)-1,14-diaza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12-hexaene.
| Compound Name | 14-methyl-4-(3-pyridin-2-ylphenoxy)-8-(2,4,6-trimethylphenyl)-1,14-diaza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12-hexaene |
|---|---|
| PubChem CID | 140630609 |
| Molecular Formula | C34H30BN3O |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 14-methyl-4-(3-pyridin-2-ylphenoxy)-8-(2,4,6-trimethylphenyl)-1,14-diaza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12-hexaene |
| SMILES | Cc1cc(C)c(B2c3ccc(Oc4cccc(-c5ccccn5)c4)cc3N3CN(C)c4cccc2c43)c(C)c1 |
| InChI | InChI=1S/C34H30BN3O/c1-22-17-23(2)33(24(3)18-22)35-28-15-14-27(39-26-10-7-9-25(19-26)30-12-5-6-16-36-30)20-32(28)38-21-37(4)31-13-8-11-29(35)34(31)38/h5-20H,21H2,1-4H3 |
| InChIKey | DTIMRMZESNBUIM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|