C50H47BN4O — CID 156629800
4-(4-tert-butyl-2-pyridinyl)-18-pyridin-2-yloxy-8,14-bis(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene (PubChem CID 156629800) has the molecular formula C50H47BN4O and a molecular weight of 730.77 g/mol. Its IUPAC name is 4-(4-tert-butyl-2-pyridinyl)-18-pyridin-2-yloxy-8,14-bis(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene.
| Compound Name | 4-(4-tert-butyl-2-pyridinyl)-18-pyridin-2-yloxy-8,14-bis(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 156629800 |
| Molecular Formula | C50H47BN4O |
| Molecular Weight | 730.77 g/mol |
| Exact Mass | 730.38 |
| IUPAC Name | 4-(4-tert-butyl-2-pyridinyl)-18-pyridin-2-yloxy-8,14-bis(2,4,6-trimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
| SMILES | Cc1cc(C)c(N2c3ccc(Oc4ccccn4)cc3B3c4cc(-c5cc(C(C)(C)C)ccn5)ccc4N(c4c(C)cc(C)cc4C)c4cccc2c43)c(C)c1 |
| InChI | InChI=1S/C50H47BN4O/c1-30-23-32(3)48(33(4)24-30)54-42-18-16-36(41-28-37(20-22-52-41)50(7,8)9)27-39(42)51-40-29-38(56-46-15-10-11-21-53-46)17-19-43(40)55(45-14-12-13-44(54)47(45)51)49-34(5)25-31(2)26-35(49)6/h10-29H,1-9H3 |
| InChIKey | JNJRJMDKWBYGBU-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.77 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|