C15H28O13 — CID 140632524
(2S,3S,4S,5S,6R)-6-[(1S)-2-[(2S,3S,4S,5S,6R)-6-[(1S)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-1-hydroxyethyl]-2-methyloxane-2,3,4,5-tetrol (PubChem CID 140632524) has the molecular formula C15H28O13 and a molecular weight of 416.38 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-6-[(1S)-2-[(2S,3S,4S,5S,6R)-6-[(1S)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-1-hydroxyethyl]-2-methyloxane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4S,5S,6R)-6-[(1S)-2-[(2S,3S,4S,5S,6R)-6-[(1S)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-1-hydroxyethyl]-2-methyloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 140632524 |
| Molecular Formula | C15H28O13 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (2S,3S,4S,5S,6R)-6-[(1S)-2-[(2S,3S,4S,5S,6R)-6-[(1S)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-1-hydroxyethyl]-2-methyloxane-2,3,4,5-tetrol |
| SMILES | C[C@]1(O)O[C@H]([C@@H](O)CO[C@H]2O[C@H]([C@@H](O)CO)[C@@H](O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H28O13/c1-15(25)13(24)9(22)8(21)12(28-15)5(18)3-26-14-10(23)6(19)7(20)11(27-14)4(17)2-16/h4-14,16-25H,2-3H2,1H3/t4-,5-,6-,7-,8-,9-,10-,11+,12+,13-,14-,15-/m0/s1 |
| InChIKey | KQMLDXJEWZCNOX-WSRIKQJVSA-N |
| XLogP | -6.29 |
| TPSA | 229.99 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | -6.29 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |