C20H24ClN3O3 — CID 140634256
1-[2-[(1-benzylpiperidin-4-yl)methoxy]-4-pyridinyl]-2-hydroxyiminoethanone;hydrochloride (PubChem CID 140634256) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is 1-[2-[(1-benzylpiperidin-4-yl)methoxy]-4-pyridinyl]-2-hydroxyiminoethanone;hydrochloride.
| Compound Name | 1-[2-[(1-benzylpiperidin-4-yl)methoxy]-4-pyridinyl]-2-hydroxyiminoethanone;hydrochloride |
|---|---|
| PubChem CID | 140634256 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1-[2-[(1-benzylpiperidin-4-yl)methoxy]-4-pyridinyl]-2-hydroxyiminoethanone;hydrochloride |
| SMILES | Cl.O=C(C=NO)c1ccnc(OCC2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H23N3O3.ClH/c24-19(13-22-25)18-6-9-21-20(12-18)26-15-17-7-10-23(11-8-17)14-16-4-2-1-3-5-16;/h1-6,9,12-13,17,25H,7-8,10-11,14-15H2;1H |
| InChIKey | MBEIBUGBGQHBEB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|