C19H22BrN3O2 — CID 166603548
4-[[1-[(3-bromophenyl)methyl]piperidin-4-yl]methoxy]pyridine-2-carboxamide (PubChem CID 166603548) has the molecular formula C19H22BrN3O2 and a molecular weight of 404.31 g/mol. Its IUPAC name is 4-[[1-[(3-bromophenyl)methyl]piperidin-4-yl]methoxy]pyridine-2-carboxamide.
| Compound Name | 4-[[1-[(3-bromophenyl)methyl]piperidin-4-yl]methoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166603548 |
| Molecular Formula | C19H22BrN3O2 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 4-[[1-[(3-bromophenyl)methyl]piperidin-4-yl]methoxy]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(OCC2CCN(Cc3cccc(Br)c3)CC2)ccn1 |
| InChI | InChI=1S/C19H22BrN3O2/c20-16-3-1-2-15(10-16)12-23-8-5-14(6-9-23)13-25-17-4-7-22-18(11-17)19(21)24/h1-4,7,10-11,14H,5-6,8-9,12-13H2,(H2,21,24) |
| InChIKey | PPUXKNDKWSQZAF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |