C17H19BrN4O2 — CID 166601537
4-[[1-(5-bromo-2-pyridinyl)piperidin-4-yl]methoxy]pyridine-2-carboxamide (PubChem CID 166601537) has the molecular formula C17H19BrN4O2 and a molecular weight of 391.27 g/mol. Its IUPAC name is 4-[[1-(5-bromo-2-pyridinyl)piperidin-4-yl]methoxy]pyridine-2-carboxamide.
| Compound Name | 4-[[1-(5-bromo-2-pyridinyl)piperidin-4-yl]methoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166601537 |
| Molecular Formula | C17H19BrN4O2 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 4-[[1-(5-bromo-2-pyridinyl)piperidin-4-yl]methoxy]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(OCC2CCN(c3ccc(Br)cn3)CC2)ccn1 |
| InChI | InChI=1S/C17H19BrN4O2/c18-13-1-2-16(21-10-13)22-7-4-12(5-8-22)11-24-14-3-6-20-15(9-14)17(19)23/h1-3,6,9-10,12H,4-5,7-8,11H2,(H2,19,23) |
| InChIKey | AIIZRNPTVMSEBN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |