C18H21N3O3S — CID 166600547
4-[[1-(5-methylthiophene-2-carbonyl)piperidin-4-yl]methoxy]pyridine-2-carboxamide (PubChem CID 166600547) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-[[1-(5-methylthiophene-2-carbonyl)piperidin-4-yl]methoxy]pyridine-2-carboxamide.
| Compound Name | 4-[[1-(5-methylthiophene-2-carbonyl)piperidin-4-yl]methoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166600547 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-[[1-(5-methylthiophene-2-carbonyl)piperidin-4-yl]methoxy]pyridine-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N2CCC(COc3ccnc(C(N)=O)c3)CC2)s1 |
| InChI | InChI=1S/C18H21N3O3S/c1-12-2-3-16(25-12)18(23)21-8-5-13(6-9-21)11-24-14-4-7-20-15(10-14)17(19)22/h2-4,7,10,13H,5-6,8-9,11H2,1H3,(H2,19,22) |
| InChIKey | ZZIAOXXUGDPZRA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |