C19H20FN4O+ — CID 140634876
[4-(dimethylamino)-3-fluorophenyl]-[6-(2-methoxyphenyl)pyrimidin-4-yl]azanium (PubChem CID 140634876) has the molecular formula C19H20FN4O+ and a molecular weight of 339.39 g/mol. Its IUPAC name is [4-(dimethylamino)-3-fluorophenyl]-[6-(2-methoxyphenyl)pyrimidin-4-yl]azanium.
| Compound Name | [4-(dimethylamino)-3-fluorophenyl]-[6-(2-methoxyphenyl)pyrimidin-4-yl]azanium |
|---|---|
| PubChem CID | 140634876 |
| Molecular Formula | C19H20FN4O+ |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | [4-(dimethylamino)-3-fluorophenyl]-[6-(2-methoxyphenyl)pyrimidin-4-yl]azanium |
| SMILES | COc1ccccc1-c1cc([NH2+]c2ccc(N(C)C)c(F)c2)ncn1 |
| InChI | InChI=1S/C19H19FN4O/c1-24(2)17-9-8-13(10-15(17)20)23-19-11-16(21-12-22-19)14-6-4-5-7-18(14)25-3/h4-12H,1-3H3,(H,21,22,23)/p+1 |
| InChIKey | TVTAXSKFTDVEJK-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|