C26H27N4O2+ — CID 144580791
benzyl-[[2-methoxy-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]phenyl]methyl]azanium (PubChem CID 144580791) has the molecular formula C26H27N4O2+ and a molecular weight of 427.53 g/mol. Its IUPAC name is benzyl-[[2-methoxy-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]phenyl]methyl]azanium.
| Compound Name | benzyl-[[2-methoxy-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 144580791 |
| Molecular Formula | C26H27N4O2+ |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | benzyl-[[2-methoxy-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]phenyl]methyl]azanium |
| SMILES | COc1ccc(Nc2cc(-c3ccccc3OC)ncn2)cc1C[NH2+]Cc1ccccc1 |
| InChI | InChI=1S/C26H26N4O2/c1-31-24-13-12-21(14-20(24)17-27-16-19-8-4-3-5-9-19)30-26-15-23(28-18-29-26)22-10-6-7-11-25(22)32-2/h3-15,18,27H,16-17H2,1-2H3,(H,28,29,30)/p+1 |
| InChIKey | RRTZIOOYMHSXQU-UHFFFAOYSA-O |
| XLogP | 4.17 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |