C22H27N4O3P — CID 90656365
3-N-[ethoxy(ethyl)phosphoryl]-1-N-[6-(2-methoxyphenyl)pyrimidin-4-yl]-4-methylbenzene-1,3-diamine (PubChem CID 90656365) has the molecular formula C22H27N4O3P and a molecular weight of 426.46 g/mol. Its IUPAC name is 3-N-[ethoxy(ethyl)phosphoryl]-1-N-[6-(2-methoxyphenyl)pyrimidin-4-yl]-4-methylbenzene-1,3-diamine.
| Compound Name | 3-N-[ethoxy(ethyl)phosphoryl]-1-N-[6-(2-methoxyphenyl)pyrimidin-4-yl]-4-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 90656365 |
| Molecular Formula | C22H27N4O3P |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 3-N-[ethoxy(ethyl)phosphoryl]-1-N-[6-(2-methoxyphenyl)pyrimidin-4-yl]-4-methylbenzene-1,3-diamine |
| SMILES | CCOP(=O)(CC)Nc1cc(Nc2cc(-c3ccccc3OC)ncn2)ccc1C |
| InChI | InChI=1S/C22H27N4O3P/c1-5-29-30(27,6-2)26-19-13-17(12-11-16(19)3)25-22-14-20(23-15-24-22)18-9-7-8-10-21(18)28-4/h7-15H,5-6H2,1-4H3,(H,26,27)(H,23,24,25) |
| InChIKey | PHEKZJHSQCVART-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|