C21H21N3O4 — CID 144580770
methyl 2-ethoxy-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]benzoate (PubChem CID 144580770) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is methyl 2-ethoxy-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 2-ethoxy-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 144580770 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | methyl 2-ethoxy-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOc1ccc(Nc2cc(-c3ccccc3OC)ncn2)cc1C(=O)OC |
| InChI | InChI=1S/C21H21N3O4/c1-4-28-19-10-9-14(11-16(19)21(25)27-3)24-20-12-17(22-13-23-20)15-7-5-6-8-18(15)26-2/h5-13H,4H2,1-3H3,(H,22,23,24) |
| InChIKey | BAJCWSXKBLKGSM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |