C22H23N3O3 — CID 174930706
[4-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]phenyl] 2,2-dimethylpropanoate (PubChem CID 174930706) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is [4-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174930706 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | [4-[[6-(2-methoxyphenyl)pyrimidin-4-yl]amino]phenyl] 2,2-dimethylpropanoate |
| SMILES | COc1ccccc1-c1cc(Nc2ccc(OC(=O)C(C)(C)C)cc2)ncn1 |
| InChI | InChI=1S/C22H23N3O3/c1-22(2,3)21(26)28-16-11-9-15(10-12-16)25-20-13-18(23-14-24-20)17-7-5-6-8-19(17)27-4/h5-14H,1-4H3,(H,23,24,25) |
| InChIKey | KRKSLFXTIVOIQZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|