C12H22ClNO4 — CID 140634895
chloromethyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pentanoate (PubChem CID 140634895) has the molecular formula C12H22ClNO4 and a molecular weight of 279.76 g/mol. Its IUPAC name is chloromethyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pentanoate.
| Compound Name | chloromethyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pentanoate |
|---|---|
| PubChem CID | 140634895 |
| Molecular Formula | C12H22ClNO4 |
| Molecular Weight | 279.76 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | chloromethyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pentanoate |
| SMILES | CCCC(CNC(=O)OC(C)(C)C)C(=O)OCCl |
| InChI | InChI=1S/C12H22ClNO4/c1-5-6-9(10(15)17-8-13)7-14-11(16)18-12(2,3)4/h9H,5-8H2,1-4H3,(H,14,16) |
| InChIKey | MQJUWXSVERSIKW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.76 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|