C15H28ClNO5 — CID 165440958
chloromethyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(propoxymethyl)pentanoate (PubChem CID 165440958) has the molecular formula C15H28ClNO5 and a molecular weight of 337.84 g/mol. Its IUPAC name is chloromethyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(propoxymethyl)pentanoate.
| Compound Name | chloromethyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(propoxymethyl)pentanoate |
|---|---|
| PubChem CID | 165440958 |
| Molecular Formula | C15H28ClNO5 |
| Molecular Weight | 337.84 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | chloromethyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(propoxymethyl)pentanoate |
| SMILES | CCCOCC(CCNC(=O)OC(C)(C)C)CC(=O)OCCl |
| InChI | InChI=1S/C15H28ClNO5/c1-5-8-20-10-12(9-13(18)21-11-16)6-7-17-14(19)22-15(2,3)4/h12H,5-11H2,1-4H3,(H,17,19) |
| InChIKey | BSMCJHOZOBQYTG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.84 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|