C29H36N8O4 — CID 140634923
7-[[(2S,3S)-3-methyl-2-[(2-phenylacetyl)amino]pentanoyl]amino]-9-oxo-N-(2H-tetrazol-5-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-2,4(13)-diene-11-carboxamide (PubChem CID 140634923) has the molecular formula C29H36N8O4 and a molecular weight of 560.66 g/mol. Its IUPAC name is 7-[[(2S,3S)-3-methyl-2-[(2-phenylacetyl)amino]pentanoyl]amino]-9-oxo-N-(2H-tetrazol-5-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-2,4(13)-diene-11-carboxamide.
| Compound Name | 7-[[(2S,3S)-3-methyl-2-[(2-phenylacetyl)amino]pentanoyl]amino]-9-oxo-N-(2H-tetrazol-5-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-2,4(13)-diene-11-carboxamide |
|---|---|
| PubChem CID | 140634923 |
| Molecular Formula | C29H36N8O4 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | 7-[[(2S,3S)-3-methyl-2-[(2-phenylacetyl)amino]pentanoyl]amino]-9-oxo-N-(2H-tetrazol-5-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-2,4(13)-diene-11-carboxamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)Cc1ccccc1)C(=O)NC1CCc2ccn3c2C1C(=O)CC(C(=O)NCc1nn[nH]n1)C3 |
| InChI | InChI=1S/C29H36N8O4/c1-3-17(2)26(32-24(39)13-18-7-5-4-6-8-18)29(41)31-21-10-9-19-11-12-37-16-20(14-22(38)25(21)27(19)37)28(40)30-15-23-33-35-36-34-23/h4-8,11-12,17,20-21,25-26H,3,9-10,13-16H2,1-2H3,(H,30,40)(H,31,41)(H,32,39)(H,33,34,35,36)/t17-,20?,21?,25?,26-/m0/s1 |
| InChIKey | NVUJXBSCSUMMLI-LKPNQPAPSA-N |
| XLogP | 1.19 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |