C58H44N6OZn+2 — CID 140635986
zinc 5,10,15-triphenyl-20-[4-[[4-(1-propylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methoxy]phenyl]porphyrin-22,24-diide (PubChem CID 140635986) has the molecular formula C58H44N6OZn+2 and a molecular weight of 906.42 g/mol. Its IUPAC name is zinc 5,10,15-triphenyl-20-[4-[[4-(1-propylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methoxy]phenyl]porphyrin-22,24-diide.
| Compound Name | zinc 5,10,15-triphenyl-20-[4-[[4-(1-propylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methoxy]phenyl]porphyrin-22,24-diide |
|---|---|
| PubChem CID | 140635986 |
| Molecular Formula | C58H44N6OZn+2 |
| Molecular Weight | 906.42 g/mol |
| Exact Mass | 904.29 |
| IUPAC Name | zinc 5,10,15-triphenyl-20-[4-[[4-(1-propylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methoxy]phenyl]porphyrin-22,24-diide |
| SMILES | CCC[n+]1ccc(-c2cc[n+](COc3ccc(-c4c5nc(c(-c6ccccc6)c6ccc([n-]6)c(-c6ccccc6)c6nc(c(-c7ccccc7)c7ccc4[n-]7)C=C6)C=C5)cc3)cc2)cc1.[Zn+2] |
| InChI | InChI=1S/C58H44N6O.Zn/c1-2-34-63-35-30-40(31-36-63)41-32-37-64(38-33-41)39-65-46-20-18-45(19-21-46)58-53-28-26-51(61-53)56(43-14-8-4-9-15-43)49-24-22-47(59-49)55(42-12-6-3-7-13-42)48-23-25-50(60-48)57(44-16-10-5-11-17-44)52-27-29-54(58)62-52;/h3-33,35-38H,2,34,39H2,1H3;/q;+2/b55-47-,55-48-,56-49-,56-51-,57-50-,57-52-,58-53-,58-54-; |
| InChIKey | OZLLVVAXGUDTND-TTYMYHKSSA-N |
| XLogP | 12.27 |
| TPSA | 70.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.42 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|