C24H21F2N5O — CID 140636139
N-[4-ethyl-5-fluoro-6-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]pyrimidin-2-yl]benzamide (PubChem CID 140636139) has the molecular formula C24H21F2N5O and a molecular weight of 433.46 g/mol. Its IUPAC name is N-[4-ethyl-5-fluoro-6-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]pyrimidin-2-yl]benzamide.
| Compound Name | N-[4-ethyl-5-fluoro-6-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]pyrimidin-2-yl]benzamide |
|---|---|
| PubChem CID | 140636139 |
| Molecular Formula | C24H21F2N5O |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-[4-ethyl-5-fluoro-6-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]pyrimidin-2-yl]benzamide |
| SMILES | CCc1nc(NC(=O)c2ccccc2)nc(CCc2ccn(-c3ccc(F)cc3)n2)c1F |
| InChI | InChI=1S/C24H21F2N5O/c1-2-20-22(26)21(28-24(27-20)29-23(32)16-6-4-3-5-7-16)13-10-18-14-15-31(30-18)19-11-8-17(25)9-12-19/h3-9,11-12,14-15H,2,10,13H2,1H3,(H,27,28,29,32) |
| InChIKey | PBNINFDHKXCXHR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |