C15H24F3NO3 — CID 140638326
N-hydroxy-2-[4-[(2,4,5-trifluorocyclohexyl)methoxy]cyclohexyl]acetamide (PubChem CID 140638326) has the molecular formula C15H24F3NO3 and a molecular weight of 323.36 g/mol. Its IUPAC name is N-hydroxy-2-[4-[(2,4,5-trifluorocyclohexyl)methoxy]cyclohexyl]acetamide.
| Compound Name | N-hydroxy-2-[4-[(2,4,5-trifluorocyclohexyl)methoxy]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 140638326 |
| Molecular Formula | C15H24F3NO3 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-hydroxy-2-[4-[(2,4,5-trifluorocyclohexyl)methoxy]cyclohexyl]acetamide |
| SMILES | O=C(CC1CCC(OCC2CC(F)C(F)CC2F)CC1)NO |
| InChI | InChI=1S/C15H24F3NO3/c16-12-7-14(18)13(17)6-10(12)8-22-11-3-1-9(2-4-11)5-15(20)19-21/h9-14,21H,1-8H2,(H,19,20) |
| InChIKey | LQNIIRVDIMPPHE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|